C11H23N7O — CID 80902362
1-N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine (PubChem CID 80902362) has the molecular formula C11H23N7O and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine.
| Compound Name | 1-N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 80902362 |
| Molecular Formula | C11H23N7O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
| SMILES | CCOc1nc(NN)nc(NCC(C)(C)N(C)C)n1 |
| InChI | InChI=1S/C11H23N7O/c1-6-19-10-15-8(14-9(16-10)17-12)13-7-11(2,3)18(4)5/h6-7,12H2,1-5H3,(H2,13,14,15,16,17) |
| InChIKey | HDWWNGVCIYIUJO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|