C11H22N6O — CID 80913146
4-ethoxy-6-hydrazinyl-N-methyl-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 80913146) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is 4-ethoxy-6-hydrazinyl-N-methyl-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-hydrazinyl-N-methyl-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80913146 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 4-ethoxy-6-hydrazinyl-N-methyl-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(NN)nc(N(C)C(C)(C)CC)n1 |
| InChI | InChI=1S/C11H22N6O/c1-6-11(3,4)17(5)9-13-8(16-12)14-10(15-9)18-7-2/h6-7,12H2,1-5H3,(H,13,14,15,16) |
| InChIKey | JAAHRRNIJIXHBL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|