C8H11N5O2 — CID 80913971
(4-ethoxy-6-prop-2-ynoxy-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80913971) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is (4-ethoxy-6-prop-2-ynoxy-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-ethoxy-6-prop-2-ynoxy-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80913971 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (4-ethoxy-6-prop-2-ynoxy-1,3,5-triazin-2-yl)hydrazine |
| SMILES | C#CCOc1nc(NN)nc(OCC)n1 |
| InChI | InChI=1S/C8H11N5O2/c1-3-5-15-8-11-6(13-9)10-7(12-8)14-4-2/h1H,4-5,9H2,2H3,(H,10,11,12,13) |
| InChIKey | OCRPMKJSBKQEGA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|