C9H17N5O2S — CID 80928778
3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-2-methylpropan-1-ol (PubChem CID 80928778) has the molecular formula C9H17N5O2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-2-methylpropan-1-ol.
| Compound Name | 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 80928778 |
| Molecular Formula | C9H17N5O2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]-2-methylpropan-1-ol |
| SMILES | CCOc1nc(NN)nc(SCC(C)CO)n1 |
| InChI | InChI=1S/C9H17N5O2S/c1-3-16-8-11-7(14-10)12-9(13-8)17-5-6(2)4-15/h6,15H,3-5,10H2,1-2H3,(H,11,12,13,14) |
| InChIKey | VFGMZDOGQKTRHC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|