C9H15N5O3S — CID 80923874
ethyl 2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]acetate (PubChem CID 80923874) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is ethyl 2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]acetate.
| Compound Name | ethyl 2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 80923874 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | ethyl 2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc(NN)nc(OCC)n1 |
| InChI | InChI=1S/C9H15N5O3S/c1-3-16-6(15)5-18-9-12-7(14-10)11-8(13-9)17-4-2/h3-5,10H2,1-2H3,(H,11,12,13,14) |
| InChIKey | WENJQDFFSPGMAZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|