About ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride
ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride (PubChem CID 45125947) has the molecular formula C10H15ClN2O2S
and a molecular weight of 262.76 g/mol. Its IUPAC name is ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride |
| PubChem CID | 45125947 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride |
| SMILES | CCOC(=O)CSc1nc(C)cc(C)n1.Cl |
| InChI | InChI=1S/C10H14N2O2S.ClH/c1-4-14-9(13)6-15-10-11-7(2)5-8(3)12-10;/h5H,4,6H2,1-3H3;1H |
| InChIKey | IHKBKGJRVRURBR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride?
The IUPAC name of ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride (CID 45125947) is ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride.
What is the SMILES notation for ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride?
The canonical SMILES for ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride is CCOC(=O)CSc1nc(C)cc(C)n1.Cl.
What is the InChIKey of ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride?
The InChIKey is IHKBKGJRVRURBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S.ClH/c1-4-14-9(13)6-15-10-11-7(2)5-8(3)12-10;/h5H,4,6H2,1-3H3;1H.
What are the key properties of ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride?
ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride has a molecular weight of 262.76 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate;hydrochloride is sourced from PubChem (CID 45125947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).