2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride

C8H9ClN2OS — CID 151547713

IUPAC2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride
SMILESCc1cc(C)nc(SCC(=O)Cl)n1
InChIInChI=1S/C8H9ClN2OS/c1-5-3-6(2)11-8(10-5)13-4-7(9)12/h3H,4H2,1-2H3
InChIKeyPZUPFHXGVDEIDU-UHFFFAOYSA-N
MW216.69 g/mol
LogP1.95
Rot. Bonds3

About 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride

2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride (PubChem CID 151547713) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride.

Molecular Properties

Compound Name2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride
PubChem CID151547713
Molecular FormulaC8H9ClN2OS
Molecular Weight216.69 g/mol
Exact Mass216.01
IUPAC Name2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride
SMILESCc1cc(C)nc(SCC(=O)Cl)n1
InChIInChI=1S/C8H9ClN2OS/c1-5-3-6(2)11-8(10-5)13-4-7(9)12/h3H,4H2,1-2H3
InChIKeyPZUPFHXGVDEIDU-UHFFFAOYSA-N
XLogP1.95
TPSA42.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.69
LogP ≤ 51.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride (CID 151547713) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride is Cc1cc(C)nc(SCC(=O)Cl)n1.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride?
The InChIKey is PZUPFHXGVDEIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2OS/c1-5-3-6(2)11-8(10-5)13-4-7(9)12/h3H,4H2,1-2H3.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride?
2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride has a molecular weight of 216.69 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride is sourced from PubChem (CID 151547713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).