C8H9ClN2OS — CID 151547713
2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride (PubChem CID 151547713) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride |
|---|---|
| PubChem CID | 151547713 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl chloride |
| SMILES | Cc1cc(C)nc(SCC(=O)Cl)n1 |
| InChI | InChI=1S/C8H9ClN2OS/c1-5-3-6(2)11-8(10-5)13-4-7(9)12/h3H,4H2,1-2H3 |
| InChIKey | PZUPFHXGVDEIDU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|