C10H13ClN2S — CID 125483482
2-[(Z)-3-chlorobut-2-enyl]sulfanyl-4,6-dimethylpyrimidine (PubChem CID 125483482) has the molecular formula C10H13ClN2S and a molecular weight of 228.75 g/mol. Its IUPAC name is 2-[(Z)-3-chlorobut-2-enyl]sulfanyl-4,6-dimethylpyrimidine.
| Compound Name | 2-[(Z)-3-chlorobut-2-enyl]sulfanyl-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 125483482 |
| Molecular Formula | C10H13ClN2S |
| Molecular Weight | 228.75 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-[(Z)-3-chlorobut-2-enyl]sulfanyl-4,6-dimethylpyrimidine |
| SMILES | C/C(Cl)=C/CSc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C10H13ClN2S/c1-7(11)4-5-14-10-12-8(2)6-9(3)13-10/h4,6H,5H2,1-3H3/b7-4- |
| InChIKey | FLKJIGFXJZIUQU-DAXSKMNVSA-N |
| XLogP | 3.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |