C9H12N4O2S — CID 77075238
4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid (PubChem CID 77075238) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid.
| Compound Name | 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77075238 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid |
| SMILES | CC(=CCSc1nc(N)cc(N)n1)C(=O)O |
| InChI | InChI=1S/C9H12N4O2S/c1-5(8(14)15)2-3-16-9-12-6(10)4-7(11)13-9/h2,4H,3H2,1H3,(H,14,15)(H4,10,11,12,13) |
| InChIKey | SSLHHJATVKGWMN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|