4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid

C9H12N4O2S — CID 77075238

IUPAC4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid
SMILESCC(=CCSc1nc(N)cc(N)n1)C(=O)O
InChIInChI=1S/C9H12N4O2S/c1-5(8(14)15)2-3-16-9-12-6(10)4-7(11)13-9/h2,4H,3H2,1H3,(H,14,15)(H4,10,11,12,13)
InChIKeySSLHHJATVKGWMN-UHFFFAOYSA-N
MW240.29 g/mol
LogP0.76
Rot. Bonds4

About 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid

4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid (PubChem CID 77075238) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid.

Molecular Properties

Compound Name4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid
PubChem CID77075238
Molecular FormulaC9H12N4O2S
Molecular Weight240.29 g/mol
Exact Mass240.07
IUPAC Name4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid
SMILESCC(=CCSc1nc(N)cc(N)n1)C(=O)O
InChIInChI=1S/C9H12N4O2S/c1-5(8(14)15)2-3-16-9-12-6(10)4-7(11)13-9/h2,4H,3H2,1H3,(H,14,15)(H4,10,11,12,13)
InChIKeySSLHHJATVKGWMN-UHFFFAOYSA-N
XLogP0.76
TPSA115.12 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.29
LogP ≤ 50.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid?
The IUPAC name of 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid (CID 77075238) is 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid.
What is the SMILES notation for 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid?
The canonical SMILES for 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid is CC(=CCSc1nc(N)cc(N)n1)C(=O)O.
What is the InChIKey of 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid?
The InChIKey is SSLHHJATVKGWMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2S/c1-5(8(14)15)2-3-16-9-12-6(10)4-7(11)13-9/h2,4H,3H2,1H3,(H,14,15)(H4,10,11,12,13).
What are the key properties of 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid?
4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid has a molecular weight of 240.29 g/mol, XLogP of 0.76, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-methylbut-2-enoic acid is sourced from PubChem (CID 77075238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).