C12H11Cl2N3S — CID 106994811
2-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine (PubChem CID 106994811) has the molecular formula C12H11Cl2N3S and a molecular weight of 300.21 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 106994811 |
| Molecular Formula | C12H11Cl2N3S |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(SCc2ccc(Cl)nc2Cl)n1 |
| InChI | InChI=1S/C12H11Cl2N3S/c1-7-5-8(2)16-12(15-7)18-6-9-3-4-10(13)17-11(9)14/h3-5H,6H2,1-2H3 |
| InChIKey | OYNYYUVNFVJULL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|