C9H14N2OS — CID 4204325
2-(2-methoxyethylsulfanyl)-4,6-dimethylpyrimidine (PubChem CID 4204325) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfanyl)-4,6-dimethylpyrimidine.
| Compound Name | 2-(2-methoxyethylsulfanyl)-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 4204325 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-(2-methoxyethylsulfanyl)-4,6-dimethylpyrimidine |
| SMILES | COCCSc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C9H14N2OS/c1-7-6-8(2)11-9(10-7)13-5-4-12-3/h6H,4-5H2,1-3H3 |
| InChIKey | BCBKJFRPAROYJS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|