C15H16N2O3S — CID 62304780
4-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethoxy]benzoic acid (PubChem CID 62304780) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethoxy]benzoic acid.
| Compound Name | 4-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethoxy]benzoic acid |
|---|---|
| PubChem CID | 62304780 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethoxy]benzoic acid |
| SMILES | Cc1cc(C)nc(SCCOc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10-9-11(2)17-15(16-10)21-8-7-20-13-5-3-12(4-6-13)14(18)19/h3-6,9H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | HBBDXBSYAKXRJQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|