C10H10N4O3S — CID 28916149
4-[2-(2H-tetrazol-5-ylsulfanyl)ethoxy]benzoic acid (PubChem CID 28916149) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is 4-[2-(2H-tetrazol-5-ylsulfanyl)ethoxy]benzoic acid.
| Compound Name | 4-[2-(2H-tetrazol-5-ylsulfanyl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 28916149 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 4-[2-(2H-tetrazol-5-ylsulfanyl)ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCSc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C10H10N4O3S/c15-9(16)7-1-3-8(4-2-7)17-5-6-18-10-11-13-14-12-10/h1-4H,5-6H2,(H,15,16)(H,11,12,13,14) |
| InChIKey | KYZTZRBCSXCMTR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|