C8H10F3N3OS — CID 115331100
6-methyl-2-[2-(trifluoromethoxy)ethylsulfanyl]pyrimidin-4-amine (PubChem CID 115331100) has the molecular formula C8H10F3N3OS and a molecular weight of 253.25 g/mol. Its IUPAC name is 6-methyl-2-[2-(trifluoromethoxy)ethylsulfanyl]pyrimidin-4-amine.
| Compound Name | 6-methyl-2-[2-(trifluoromethoxy)ethylsulfanyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 115331100 |
| Molecular Formula | C8H10F3N3OS |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 6-methyl-2-[2-(trifluoromethoxy)ethylsulfanyl]pyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(SCCOC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3OS/c1-5-4-6(12)14-7(13-5)16-3-2-15-8(9,10)11/h4H,2-3H2,1H3,(H2,12,13,14) |
| InChIKey | JXFKOCQHSCASMC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|