C9H13N3O2S — CID 115279578
methyl 3-(4-amino-6-methylpyrimidin-2-yl)sulfanylpropanoate (PubChem CID 115279578) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is methyl 3-(4-amino-6-methylpyrimidin-2-yl)sulfanylpropanoate.
| Compound Name | methyl 3-(4-amino-6-methylpyrimidin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 115279578 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | methyl 3-(4-amino-6-methylpyrimidin-2-yl)sulfanylpropanoate |
| SMILES | COC(=O)CCSc1nc(C)cc(N)n1 |
| InChI | InChI=1S/C9H13N3O2S/c1-6-5-7(10)12-9(11-6)15-4-3-8(13)14-2/h5H,3-4H2,1-2H3,(H2,10,11,12) |
| InChIKey | BBUMTEBJIQLJFN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |