C9H14N4OS — CID 115331106
3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methylpropanamide (PubChem CID 115331106) has the molecular formula C9H14N4OS and a molecular weight of 226.31 g/mol. Its IUPAC name is 3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methylpropanamide.
| Compound Name | 3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methylpropanamide |
|---|---|
| PubChem CID | 115331106 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methylpropanamide |
| SMILES | CNC(=O)CCSc1nc(C)cc(N)n1 |
| InChI | InChI=1S/C9H14N4OS/c1-6-5-7(10)13-9(12-6)15-4-3-8(14)11-2/h5H,3-4H2,1-2H3,(H,11,14)(H2,10,12,13) |
| InChIKey | OOVSYLKGJGXXOW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |