C13H13N5OS2 — CID 115279669
3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide (PubChem CID 115279669) has the molecular formula C13H13N5OS2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide.
| Compound Name | 3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 115279669 |
| Molecular Formula | C13H13N5OS2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide |
| SMILES | Cc1cc(N)nc(SCCC(=O)Nc2sccc2C#N)n1 |
| InChI | InChI=1S/C13H13N5OS2/c1-8-6-10(15)17-13(16-8)21-5-3-11(19)18-12-9(7-14)2-4-20-12/h2,4,6H,3,5H2,1H3,(H,18,19)(H2,15,16,17) |
| InChIKey | NHGNAMROONBMIS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |