C12H17N3OS2 — CID 66220996
3-(2-amino-2-methylpropyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide (PubChem CID 66220996) has the molecular formula C12H17N3OS2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 3-(2-amino-2-methylpropyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide.
| Compound Name | 3-(2-amino-2-methylpropyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 66220996 |
| Molecular Formula | C12H17N3OS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-(2-amino-2-methylpropyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide |
| SMILES | CC(C)(N)CSCCC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C12H17N3OS2/c1-12(2,14)8-17-5-4-10(16)15-11-9(7-13)3-6-18-11/h3,6H,4-5,8,14H2,1-2H3,(H,15,16) |
| InChIKey | BEEMDVALUWERTF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|