C7H10FN3S — CID 79026200
2-(2-fluoroethylsulfanyl)-6-methylpyrimidin-4-amine (PubChem CID 79026200) has the molecular formula C7H10FN3S and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(2-fluoroethylsulfanyl)-6-methylpyrimidin-4-amine.
| Compound Name | 2-(2-fluoroethylsulfanyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79026200 |
| Molecular Formula | C7H10FN3S |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 2-(2-fluoroethylsulfanyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(SCCF)n1 |
| InChI | InChI=1S/C7H10FN3S/c1-5-4-6(9)11-7(10-5)12-3-2-8/h4H,2-3H2,1H3,(H2,9,10,11) |
| InChIKey | MYTZVZAFFGKIHG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |