C10H13N3S — CID 104744126
6-methyl-2-pent-3-ynylsulfanylpyrimidin-4-amine (PubChem CID 104744126) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 6-methyl-2-pent-3-ynylsulfanylpyrimidin-4-amine.
| Compound Name | 6-methyl-2-pent-3-ynylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 104744126 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 6-methyl-2-pent-3-ynylsulfanylpyrimidin-4-amine |
| SMILES | CC#CCCSc1nc(C)cc(N)n1 |
| InChI | InChI=1S/C10H13N3S/c1-3-4-5-6-14-10-12-8(2)7-9(11)13-10/h7H,5-6H2,1-2H3,(H2,11,12,13) |
| InChIKey | OURNODNGDYLUKC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|