C7H12N6O2S — CID 66337524
hydrazinyl 3-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate (PubChem CID 66337524) has the molecular formula C7H12N6O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is hydrazinyl 3-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate.
| Compound Name | hydrazinyl 3-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 66337524 |
| Molecular Formula | C7H12N6O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | hydrazinyl 3-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate |
| SMILES | NNOC(=O)CCSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C7H12N6O2S/c8-4-3-5(9)12-7(11-4)16-2-1-6(14)15-13-10/h3,13H,1-2,10H2,(H4,8,9,11,12) |
| InChIKey | IRFQOJXYCSMWSF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|