C10H11N3O3S — CID 66337338
hydrazinyl 3-(1,3-benzoxazol-2-ylsulfanyl)propanoate (PubChem CID 66337338) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is hydrazinyl 3-(1,3-benzoxazol-2-ylsulfanyl)propanoate.
| Compound Name | hydrazinyl 3-(1,3-benzoxazol-2-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 66337338 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | hydrazinyl 3-(1,3-benzoxazol-2-ylsulfanyl)propanoate |
| SMILES | NNOC(=O)CCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H11N3O3S/c11-13-16-9(14)5-6-17-10-12-7-3-1-2-4-8(7)15-10/h1-4,13H,5-6,11H2 |
| InChIKey | HZOQFVXUTTXUNQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|