C13H15NO2S — CID 104623359
6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-one (PubChem CID 104623359) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-one.
| Compound Name | 6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-one |
|---|---|
| PubChem CID | 104623359 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-one |
| SMILES | CCC(=O)CCCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H15NO2S/c1-2-10(15)6-5-9-17-13-14-11-7-3-4-8-12(11)16-13/h3-4,7-8H,2,5-6,9H2,1H3 |
| InChIKey | YSXLVBLHLKGDSF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|