C16H22BrNOS — CID 105343447
2-(9-bromononylsulfanyl)-1,3-benzoxazole (PubChem CID 105343447) has the molecular formula C16H22BrNOS and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-(9-bromononylsulfanyl)-1,3-benzoxazole.
| Compound Name | 2-(9-bromononylsulfanyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 105343447 |
| Molecular Formula | C16H22BrNOS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-(9-bromononylsulfanyl)-1,3-benzoxazole |
| SMILES | BrCCCCCCCCCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H22BrNOS/c17-12-8-4-2-1-3-5-9-13-20-16-18-14-10-6-7-11-15(14)19-16/h6-7,10-11H,1-5,8-9,12-13H2 |
| InChIKey | LGJVNYOEAHKHHV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|