C12H16N2OS — CID 61386489
3-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpropan-1-amine (PubChem CID 61386489) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpropan-1-amine.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 61386489 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpropan-1-amine |
| SMILES | CCNCCCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C12H16N2OS/c1-2-13-8-5-9-16-12-14-10-6-3-4-7-11(10)15-12/h3-4,6-7,13H,2,5,8-9H2,1H3 |
| InChIKey | JPNPDGULTJZFCF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|