C16H17N5O2S — CID 18584279
1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(4-methylpyrimidin-2-yl)urea (PubChem CID 18584279) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(4-methylpyrimidin-2-yl)urea.
| Compound Name | 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(4-methylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 18584279 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(4-methylpyrimidin-2-yl)urea |
| SMILES | Cc1ccnc(NC(=O)NCCCSc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C16H17N5O2S/c1-11-7-9-17-14(19-11)21-15(22)18-8-4-10-24-16-20-12-5-2-3-6-13(12)23-16/h2-3,5-7,9H,4,8,10H2,1H3,(H2,17,18,19,21,22) |
| InChIKey | WPJRKAWGPTYWIY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|