C19H21N3O2S2 — CID 69278120
6-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-methylsulfanyl-2-pyridinyl)hexanamide (PubChem CID 69278120) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-methylsulfanyl-2-pyridinyl)hexanamide.
| Compound Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-methylsulfanyl-2-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 69278120 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-methylsulfanyl-2-pyridinyl)hexanamide |
| SMILES | CSc1ccc(NC(=O)CCCCCSc2nc3ccccc3o2)nc1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-25-14-10-11-17(20-13-14)22-18(23)9-3-2-6-12-26-19-21-15-7-4-5-8-16(15)24-19/h4-5,7-8,10-11,13H,2-3,6,9,12H2,1H3,(H,20,22,23) |
| InChIKey | COWZOUMCCQAOPJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|