C24H31N3O2S — CID 22666135
N-[2,6-di(propan-2-yl)phenyl]-6-([1,3]oxazolo[4,5-c]pyridin-2-ylsulfanyl)hexanamide (PubChem CID 22666135) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-6-([1,3]oxazolo[4,5-c]pyridin-2-ylsulfanyl)hexanamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-6-([1,3]oxazolo[4,5-c]pyridin-2-ylsulfanyl)hexanamide |
|---|---|
| PubChem CID | 22666135 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-6-([1,3]oxazolo[4,5-c]pyridin-2-ylsulfanyl)hexanamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CCCCCSc1nc2cnccc2o1 |
| InChI | InChI=1S/C24H31N3O2S/c1-16(2)18-9-8-10-19(17(3)4)23(18)27-22(28)11-6-5-7-14-30-24-26-20-15-25-13-12-21(20)29-24/h8-10,12-13,15-17H,5-7,11,14H2,1-4H3,(H,27,28) |
| InChIKey | QTQBIHJOILZFEJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|