C28H36N2O4S — CID 22666115
ethyl 2-[6-[2,6-di(propan-2-yl)anilino]-6-oxohexyl]sulfanyl-1,3-benzoxazole-7-carboxylate (PubChem CID 22666115) has the molecular formula C28H36N2O4S and a molecular weight of 496.67 g/mol. Its IUPAC name is ethyl 2-[6-[2,6-di(propan-2-yl)anilino]-6-oxohexyl]sulfanyl-1,3-benzoxazole-7-carboxylate.
| Compound Name | ethyl 2-[6-[2,6-di(propan-2-yl)anilino]-6-oxohexyl]sulfanyl-1,3-benzoxazole-7-carboxylate |
|---|---|
| PubChem CID | 22666115 |
| Molecular Formula | C28H36N2O4S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | ethyl 2-[6-[2,6-di(propan-2-yl)anilino]-6-oxohexyl]sulfanyl-1,3-benzoxazole-7-carboxylate |
| SMILES | CCOC(=O)c1cccc2nc(SCCCCCC(=O)Nc3c(C(C)C)cccc3C(C)C)oc12 |
| InChI | InChI=1S/C28H36N2O4S/c1-6-33-27(32)22-14-11-15-23-26(22)34-28(29-23)35-17-9-7-8-16-24(31)30-25-20(18(2)3)12-10-13-21(25)19(4)5/h10-15,18-19H,6-9,16-17H2,1-5H3,(H,30,31) |
| InChIKey | OWGQBHKMBATISE-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|