C29H37F3N2O2S — CID 22666098
N-[2,6-di(propan-2-yl)phenyl]-9-[[7-(trifluoromethyl)-1,3-benzoxazol-2-yl]sulfanyl]nonanamide (PubChem CID 22666098) has the molecular formula C29H37F3N2O2S and a molecular weight of 534.69 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-9-[[7-(trifluoromethyl)-1,3-benzoxazol-2-yl]sulfanyl]nonanamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-9-[[7-(trifluoromethyl)-1,3-benzoxazol-2-yl]sulfanyl]nonanamide |
|---|---|
| PubChem CID | 22666098 |
| Molecular Formula | C29H37F3N2O2S |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-9-[[7-(trifluoromethyl)-1,3-benzoxazol-2-yl]sulfanyl]nonanamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CCCCCCCCSc1nc2cccc(C(F)(F)F)c2o1 |
| InChI | InChI=1S/C29H37F3N2O2S/c1-19(2)21-13-11-14-22(20(3)4)26(21)34-25(35)17-9-7-5-6-8-10-18-37-28-33-24-16-12-15-23(27(24)36-28)29(30,31)32/h11-16,19-20H,5-10,17-18H2,1-4H3,(H,34,35) |
| InChIKey | NAXZEGSHBSFEAJ-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|