C27H37N3OS2 — CID 54353381
6-[[6-(dimethylamino)-1,3-benzothiazol-2-yl]sulfanyl]-N-[2,6-di(propan-2-yl)phenyl]hexanamide (PubChem CID 54353381) has the molecular formula C27H37N3OS2 and a molecular weight of 483.75 g/mol. Its IUPAC name is 6-[[6-(dimethylamino)-1,3-benzothiazol-2-yl]sulfanyl]-N-[2,6-di(propan-2-yl)phenyl]hexanamide.
| Compound Name | 6-[[6-(dimethylamino)-1,3-benzothiazol-2-yl]sulfanyl]-N-[2,6-di(propan-2-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 54353381 |
| Molecular Formula | C27H37N3OS2 |
| Molecular Weight | 483.75 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 6-[[6-(dimethylamino)-1,3-benzothiazol-2-yl]sulfanyl]-N-[2,6-di(propan-2-yl)phenyl]hexanamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CCCCCSc1nc2ccc(N(C)C)cc2s1 |
| InChI | InChI=1S/C27H37N3OS2/c1-18(2)21-11-10-12-22(19(3)4)26(21)29-25(31)13-8-7-9-16-32-27-28-23-15-14-20(30(5)6)17-24(23)33-27/h10-12,14-15,17-19H,7-9,13,16H2,1-6H3,(H,29,31) |
| InChIKey | UHJIHUCJXRNEHM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.75 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|