C19H27NO3S2 — CID 17368558
methyl 9-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]nonanoate (PubChem CID 17368558) has the molecular formula C19H27NO3S2 and a molecular weight of 381.56 g/mol. Its IUPAC name is methyl 9-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]nonanoate.
| Compound Name | methyl 9-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]nonanoate |
|---|---|
| PubChem CID | 17368558 |
| Molecular Formula | C19H27NO3S2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl 9-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]nonanoate |
| SMILES | CCOc1ccc2nc(SCCCCCCCCC(=O)OC)sc2c1 |
| InChI | InChI=1S/C19H27NO3S2/c1-3-23-15-11-12-16-17(14-15)25-19(20-16)24-13-9-7-5-4-6-8-10-18(21)22-2/h11-12,14H,3-10,13H2,1-2H3 |
| InChIKey | MZLAVHZLUNYKTK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|