C13H15NO3S2 — CID 82192417
3-[(6-propoxy-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid (PubChem CID 82192417) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[(6-propoxy-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(6-propoxy-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 82192417 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-[(6-propoxy-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid |
| SMILES | CCCOc1ccc2nc(SCCC(=O)O)sc2c1 |
| InChI | InChI=1S/C13H15NO3S2/c1-2-6-17-9-3-4-10-11(8-9)19-13(14-10)18-7-5-12(15)16/h3-4,8H,2,5-7H2,1H3,(H,15,16) |
| InChIKey | JPBINVCBKNDUCK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |