C18H12N2O4S2 — CID 1364156
3-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 1364156) has the molecular formula C18H12N2O4S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | 3-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 1364156 |
| Molecular Formula | C18H12N2O4S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 3-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSc1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2s1 |
| InChI | InChI=1S/C18H12N2O4S2/c21-15(22)7-8-25-18-19-13-6-5-10(9-14(13)26-18)20-16(23)11-3-1-2-4-12(11)17(20)24/h1-6,9H,7-8H2,(H,21,22) |
| InChIKey | ZBOPIODORYUGDW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|