C27H23N3O3S2 — CID 23767207
N-cyclohexyl-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 23767207) has the molecular formula C27H23N3O3S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-cyclohexyl-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 23767207 |
| Molecular Formula | C27H23N3O3S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N-cyclohexyl-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)c4cccc5cccc(c45)C3=O)cc2s1)NC1CCCCC1 |
| InChI | InChI=1S/C27H23N3O3S2/c31-23(28-17-8-2-1-3-9-17)15-34-27-29-21-13-12-18(14-22(21)35-27)30-25(32)19-10-4-6-16-7-5-11-20(24(16)19)26(30)33/h4-7,10-14,17H,1-3,8-9,15H2,(H,28,31) |
| InChIKey | XXUXRFPQLPAURJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|