C29H19N3O3S2 — CID 3999142
N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 3999142) has the molecular formula C29H19N3O3S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3999142 |
| Molecular Formula | C29H19N3O3S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2s1)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C29H19N3O3S2/c33-25(30-22-12-10-17-9-8-16-4-3-7-21(22)26(16)17)15-36-29-31-23-13-11-18(14-24(23)37-29)32-27(34)19-5-1-2-6-20(19)28(32)35/h1-7,10-14H,8-9,15H2,(H,30,33) |
| InChIKey | QIFXXEPZWPVVNG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|