C30H23N3O3S2 — CID 126342826
N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 126342826) has the molecular formula C30H23N3O3S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 126342826 |
| Molecular Formula | C30H23N3O3S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-[[6-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc2s1)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C30H23N3O3S2/c34-24(31-21-10-8-16-5-4-15-2-1-3-20(21)25(15)16)14-37-30-32-22-11-9-19(13-23(22)38-30)33-28(35)26-17-6-7-18(12-17)27(26)29(33)36/h1-3,6-11,13,17-18,26-27H,4-5,12,14H2,(H,31,34)/t17-,18-,26-,27+/m0/s1 |
| InChIKey | PGPOFFUXAIFFBB-NNMFVCILSA-N |
| XLogP | 5.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|