C26H27N3O3S2 — CID 17389111
2-[[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 17389111) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is 2-[[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17389111 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)CSc2nc3ccc(N4C(=O)C5CCCCC5C4=O)cc3s2)cc1 |
| InChI | InChI=1S/C26H27N3O3S2/c1-15(2)16-7-9-17(10-8-16)27-23(30)14-33-26-28-21-12-11-18(13-22(21)34-26)29-24(31)19-5-3-4-6-20(19)25(29)32/h7-13,15,19-20H,3-6,14H2,1-2H3,(H,27,30) |
| InChIKey | BDUIJAZLUYGCQN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|