C25H21N3O4S2 — CID 126337467
2-[[6-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide (PubChem CID 126337467) has the molecular formula C25H21N3O4S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[[6-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[[6-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126337467 |
| Molecular Formula | C25H21N3O4S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-[[6-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CSc2nc3ccc(N4C(=O)[C@@H]5[C@H](C4=O)[C@H]4C=C[C@H]5C4)cc3s2)c1 |
| InChI | InChI=1S/C25H21N3O4S2/c1-32-17-4-2-3-15(10-17)26-20(29)12-33-25-27-18-8-7-16(11-19(18)34-25)28-23(30)21-13-5-6-14(9-13)22(21)24(28)31/h2-8,10-11,13-14,21-22H,9,12H2,1H3,(H,26,29)/t13-,14-,21-,22+/m0/s1 |
| InChIKey | ASTOLLKECOQNLX-GKHNXXNSSA-N |
| XLogP | 4.35 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|