C24H18N2O4S2 — CID 98122539
4-[[6-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzoic acid (PubChem CID 98122539) has the molecular formula C24H18N2O4S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 4-[[6-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 4-[[6-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 98122539 |
| Molecular Formula | C24H18N2O4S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-[[6-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CSc2nc3ccc(N4C(=O)[C@@H]5[C@@H](C4=O)[C@H]4C=C[C@H]5C4)cc3s2)cc1 |
| InChI | InChI=1S/C24H18N2O4S2/c27-21-19-14-5-6-15(9-14)20(19)22(28)26(21)16-7-8-17-18(10-16)32-24(25-17)31-11-12-1-3-13(4-2-12)23(29)30/h1-8,10,14-15,19-20H,9,11H2,(H,29,30)/t14-,15-,19-,20-/m0/s1 |
| InChIKey | NGZVMRYAACZTOO-SLUIBLPYSA-N |
| XLogP | 4.60 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|