C22H20N2O2S2 — CID 98539807
(1R,2S,6S,7R)-4-[2-[(1R)-cyclohex-2-en-1-yl]sulfanyl-1,3-benzothiazol-6-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98539807) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-[2-[(1R)-cyclohex-2-en-1-yl]sulfanyl-1,3-benzothiazol-6-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-[2-[(1R)-cyclohex-2-en-1-yl]sulfanyl-1,3-benzothiazol-6-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98539807 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (1R,2S,6S,7R)-4-[2-[(1R)-cyclohex-2-en-1-yl]sulfanyl-1,3-benzothiazol-6-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc3nc(S[C@H]4C=CCCC4)sc3c1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C22H20N2O2S2/c25-20-18-12-6-7-13(10-12)19(18)21(26)24(20)14-8-9-16-17(11-14)28-22(23-16)27-15-4-2-1-3-5-15/h2,4,6-9,11-13,15,18-19H,1,3,5,10H2/t12-,13-,15-,18-,19-/m0/s1 |
| InChIKey | LEFZOUDMQFBAFK-QBQAKCNGSA-N |
| XLogP | 4.81 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|