C28H24N2O2S2 — CID 126339522
(3aR,7aR)-2-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 126339522) has the molecular formula C28H24N2O2S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is (3aR,7aR)-2-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 126339522 |
| Molecular Formula | C28H24N2O2S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (3aR,7aR)-2-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCC[C@H]2C(=O)N1c1ccc2nc(SC(c3ccccc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C28H24N2O2S2/c31-26-21-13-7-8-14-22(21)27(32)30(26)20-15-16-23-24(17-20)33-28(29-23)34-25(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,15-17,21-22,25H,7-8,13-14H2/t21-,22-/m1/s1 |
| InChIKey | GUVZUPGIHZCPEX-FGZHOGPDSA-N |
| XLogP | 6.86 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|