C25H25N3O3S2 — CID 126343579
2-[[6-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 126343579) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-[[6-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[6-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 126343579 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-[[6-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)[C@H]4CCCC[C@@H]4C3=O)cc2s1)NCCc1ccccc1 |
| InChI | InChI=1S/C25H25N3O3S2/c29-22(26-13-12-16-6-2-1-3-7-16)15-32-25-27-20-11-10-17(14-21(20)33-25)28-23(30)18-8-4-5-9-19(18)24(28)31/h1-3,6-7,10-11,14,18-19H,4-5,8-9,12-13,15H2,(H,26,29)/t18-,19-/m0/s1 |
| InChIKey | UDNICMDWSJEBGV-OALUTQOASA-N |
| XLogP | 4.43 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|