C26H24ClN3O3S2 — CID 124530142
N-[2-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylpropanamide (PubChem CID 124530142) has the molecular formula C26H24ClN3O3S2 and a molecular weight of 526.08 g/mol. Its IUPAC name is N-[2-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylpropanamide.
| Compound Name | N-[2-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 124530142 |
| Molecular Formula | C26H24ClN3O3S2 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | N-[2-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylpropanamide |
| SMILES | O=C(CSc1nc2ccc(NC(=O)CCc3ccccc3)cc2s1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClN3O3S2/c27-19-7-10-21(11-8-19)33-15-14-28-25(32)17-34-26-30-22-12-9-20(16-23(22)35-26)29-24(31)13-6-18-4-2-1-3-5-18/h1-5,7-12,16H,6,13-15,17H2,(H,28,32)(H,29,31) |
| InChIKey | DYECNHBEDVQKGS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|