C17H16N2O2S2 — CID 4781570
N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-phenoxypropanamide (PubChem CID 4781570) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-phenoxypropanamide.
| Compound Name | N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-phenoxypropanamide |
|---|---|
| PubChem CID | 4781570 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-phenoxypropanamide |
| SMILES | CSc1nc2ccc(NC(=O)CCOc3ccccc3)cc2s1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-22-17-19-14-8-7-12(11-15(14)23-17)18-16(20)9-10-21-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,18,20) |
| InChIKey | QSSICACATQJKCT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |