C23H19ClN2O3S2 — CID 23613213
2-(2-chlorophenoxy)-N-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]acetamide (PubChem CID 23613213) has the molecular formula C23H19ClN2O3S2 and a molecular weight of 471.00 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 23613213 |
| Molecular Formula | C23H19ClN2O3S2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)Nc1ccc2nc(SCCOc3ccccc3)sc2c1 |
| InChI | InChI=1S/C23H19ClN2O3S2/c24-18-8-4-5-9-20(18)29-15-22(27)25-16-10-11-19-21(14-16)31-23(26-19)30-13-12-28-17-6-2-1-3-7-17/h1-11,14H,12-13,15H2,(H,25,27) |
| InChIKey | REYQENHLQNMCDH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|