C24H21N3O4S2 — CID 46268769
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]urea (PubChem CID 46268769) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]urea |
|---|---|
| PubChem CID | 46268769 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(2-phenoxyethylsulfanyl)-1,3-benzothiazol-6-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)Nc1ccc2nc(SCCOc3ccccc3)sc2c1 |
| InChI | InChI=1S/C24H21N3O4S2/c28-23(25-16-7-9-20-21(14-16)31-11-10-30-20)26-17-6-8-19-22(15-17)33-24(27-19)32-13-12-29-18-4-2-1-3-5-18/h1-9,14-15H,10-13H2,(H2,25,26,28) |
| InChIKey | RKAWYWFMOGJQRR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|