C25H21N3O4S2 — CID 16551505
N-(1,3-benzodioxol-5-yl)-2-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzamide (PubChem CID 16551505) has the molecular formula C25H21N3O4S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzamide |
|---|---|
| PubChem CID | 16551505 |
| Molecular Formula | C25H21N3O4S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzamide |
| SMILES | O=C(CCCSc1nc2ccccc2s1)Nc1ccccc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H21N3O4S2/c29-23(10-5-13-33-25-28-19-8-3-4-9-22(19)34-25)27-18-7-2-1-6-17(18)24(30)26-16-11-12-20-21(14-16)32-15-31-20/h1-4,6-9,11-12,14H,5,10,13,15H2,(H,26,30)(H,27,29) |
| InChIKey | DZMCPFJILPEPDY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|