C20H21N3O4 — CID 17435797
N-(1,3-benzodioxol-5-yl)-2-[(2-pyrrolidin-1-ylacetyl)amino]benzamide (PubChem CID 17435797) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(2-pyrrolidin-1-ylacetyl)amino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(2-pyrrolidin-1-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 17435797 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(2-pyrrolidin-1-ylacetyl)amino]benzamide |
| SMILES | O=C(CN1CCCC1)Nc1ccccc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21N3O4/c24-19(12-23-9-3-4-10-23)22-16-6-2-1-5-15(16)20(25)21-14-7-8-17-18(11-14)27-13-26-17/h1-2,5-8,11H,3-4,9-10,12-13H2,(H,21,25)(H,22,24) |
| InChIKey | HUEFPCIPEUPRKY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |