C29H25N3O4 — CID 2516875
2-[[2-(benzhydrylamino)acetyl]amino]-N-(1,3-benzodioxol-5-yl)benzamide (PubChem CID 2516875) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-[[2-(benzhydrylamino)acetyl]amino]-N-(1,3-benzodioxol-5-yl)benzamide.
| Compound Name | 2-[[2-(benzhydrylamino)acetyl]amino]-N-(1,3-benzodioxol-5-yl)benzamide |
|---|---|
| PubChem CID | 2516875 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[[2-(benzhydrylamino)acetyl]amino]-N-(1,3-benzodioxol-5-yl)benzamide |
| SMILES | O=C(CNC(c1ccccc1)c1ccccc1)Nc1ccccc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H25N3O4/c33-27(18-30-28(20-9-3-1-4-10-20)21-11-5-2-6-12-21)32-24-14-8-7-13-23(24)29(34)31-22-15-16-25-26(17-22)36-19-35-25/h1-17,28,30H,18-19H2,(H,31,34)(H,32,33) |
| InChIKey | YICUEIGENKEXBJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |